C26H29N3O3 — CID 155727313
2-[2-[bis[(4-methoxyphenyl)methyl]amino]-5-methoxy-4-pyridinyl]-2-methylpropanenitrile (PubChem CID 155727313) has the molecular formula C26H29N3O3 and a molecular weight of 431.54 g/mol. Its IUPAC name is 2-[2-[bis[(4-methoxyphenyl)methyl]amino]-5-methoxy-4-pyridinyl]-2-methylpropanenitrile.
| Compound Name | 2-[2-[bis[(4-methoxyphenyl)methyl]amino]-5-methoxy-4-pyridinyl]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 155727313 |
| Molecular Formula | C26H29N3O3 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | 2-[2-[bis[(4-methoxyphenyl)methyl]amino]-5-methoxy-4-pyridinyl]-2-methylpropanenitrile |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)c2cc(C(C)(C)C#N)c(OC)cn2)cc1 |
| InChI | InChI=1S/C26H29N3O3/c1-26(2,18-27)23-14-25(28-15-24(23)32-5)29(16-19-6-10-21(30-3)11-7-19)17-20-8-12-22(31-4)13-9-20/h6-15H,16-17H2,1-5H3 |
| InChIKey | ULHNUNRAJYPLGA-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 67.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |