C22H19BrClF3N2O2 — CID 172607469
6-bromo-4-chloro-N,N-bis[(4-methoxyphenyl)methyl]-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 172607469) has the molecular formula C22H19BrClF3N2O2 and a molecular weight of 515.76 g/mol. Its IUPAC name is 6-bromo-4-chloro-N,N-bis[(4-methoxyphenyl)methyl]-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 6-bromo-4-chloro-N,N-bis[(4-methoxyphenyl)methyl]-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 172607469 |
| Molecular Formula | C22H19BrClF3N2O2 |
| Molecular Weight | 515.76 g/mol |
| Exact Mass | 514.03 |
| IUPAC Name | 6-bromo-4-chloro-N,N-bis[(4-methoxyphenyl)methyl]-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)c2cc(Cl)c(C(F)(F)F)c(Br)n2)cc1 |
| InChI | InChI=1S/C22H19BrClF3N2O2/c1-30-16-7-3-14(4-8-16)12-29(13-15-5-9-17(31-2)10-6-15)19-11-18(24)20(21(23)28-19)22(25,26)27/h3-11H,12-13H2,1-2H3 |
| InChIKey | LVAMYAGOTPYMEJ-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.76 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|