C24H25BrN2O2 — CID 170704626
6-bromo-5-cyclopropyl-N,N-bis[(4-methoxyphenyl)methyl]pyridin-2-amine (PubChem CID 170704626) has the molecular formula C24H25BrN2O2 and a molecular weight of 453.38 g/mol. Its IUPAC name is 6-bromo-5-cyclopropyl-N,N-bis[(4-methoxyphenyl)methyl]pyridin-2-amine.
| Compound Name | 6-bromo-5-cyclopropyl-N,N-bis[(4-methoxyphenyl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 170704626 |
| Molecular Formula | C24H25BrN2O2 |
| Molecular Weight | 453.38 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | 6-bromo-5-cyclopropyl-N,N-bis[(4-methoxyphenyl)methyl]pyridin-2-amine |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)c2ccc(C3CC3)c(Br)n2)cc1 |
| InChI | InChI=1S/C24H25BrN2O2/c1-28-20-9-3-17(4-10-20)15-27(16-18-5-11-21(29-2)12-6-18)23-14-13-22(19-7-8-19)24(25)26-23/h3-6,9-14,19H,7-8,15-16H2,1-2H3 |
| InChIKey | LRYPDTMLSZUYLD-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.38 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|