C22H20BrF3N2O — CID 164875848
6-bromo-N-[(4-methoxyphenyl)methyl]-N-[(4-methylphenyl)methyl]-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 164875848) has the molecular formula C22H20BrF3N2O and a molecular weight of 465.31 g/mol. Its IUPAC name is 6-bromo-N-[(4-methoxyphenyl)methyl]-N-[(4-methylphenyl)methyl]-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 6-bromo-N-[(4-methoxyphenyl)methyl]-N-[(4-methylphenyl)methyl]-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 164875848 |
| Molecular Formula | C22H20BrF3N2O |
| Molecular Weight | 465.31 g/mol |
| Exact Mass | 464.07 |
| IUPAC Name | 6-bromo-N-[(4-methoxyphenyl)methyl]-N-[(4-methylphenyl)methyl]-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | COc1ccc(CN(Cc2ccc(C)cc2)c2ccc(C(F)(F)F)c(Br)n2)cc1 |
| InChI | InChI=1S/C22H20BrF3N2O/c1-15-3-5-16(6-4-15)13-28(14-17-7-9-18(29-2)10-8-17)20-12-11-19(21(23)27-20)22(24,25)26/h3-12H,13-14H2,1-2H3 |
| InChIKey | AUURIIUUCVTHHO-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.31 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|