C25H25F3N2O3S — CID 170423257
N,N-bis[(4-methoxyphenyl)methyl]-6-prop-2-enylsulfinyl-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 170423257) has the molecular formula C25H25F3N2O3S and a molecular weight of 490.55 g/mol. Its IUPAC name is N,N-bis[(4-methoxyphenyl)methyl]-6-prop-2-enylsulfinyl-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N,N-bis[(4-methoxyphenyl)methyl]-6-prop-2-enylsulfinyl-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 170423257 |
| Molecular Formula | C25H25F3N2O3S |
| Molecular Weight | 490.55 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | N,N-bis[(4-methoxyphenyl)methyl]-6-prop-2-enylsulfinyl-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | C=CCS(=O)c1nc(N(Cc2ccc(OC)cc2)Cc2ccc(OC)cc2)ccc1C(F)(F)F |
| InChI | InChI=1S/C25H25F3N2O3S/c1-4-15-34(31)24-22(25(26,27)28)13-14-23(29-24)30(16-18-5-9-20(32-2)10-6-18)17-19-7-11-21(33-3)12-8-19/h4-14H,1,15-17H2,2-3H3 |
| InChIKey | JMYBVEBYMVWZGO-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.55 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|