C24H24F3NO2S — CID 143285654
N-[[4-(4-methoxyphenyl)phenyl]methyl]-N-propyl-2-(trifluoromethyl)benzenesulfinamide (PubChem CID 143285654) has the molecular formula C24H24F3NO2S and a molecular weight of 447.52 g/mol. Its IUPAC name is N-[[4-(4-methoxyphenyl)phenyl]methyl]-N-propyl-2-(trifluoromethyl)benzenesulfinamide.
| Compound Name | N-[[4-(4-methoxyphenyl)phenyl]methyl]-N-propyl-2-(trifluoromethyl)benzenesulfinamide |
|---|---|
| PubChem CID | 143285654 |
| Molecular Formula | C24H24F3NO2S |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | N-[[4-(4-methoxyphenyl)phenyl]methyl]-N-propyl-2-(trifluoromethyl)benzenesulfinamide |
| SMILES | CCCN(Cc1ccc(-c2ccc(OC)cc2)cc1)S(=O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C24H24F3NO2S/c1-3-16-28(31(29)23-7-5-4-6-22(23)24(25,26)27)17-18-8-10-19(11-9-18)20-12-14-21(30-2)15-13-20/h4-15H,3,16-17H2,1-2H3 |
| InChIKey | CTVQICKOCPFBSJ-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |