C22H22BrNO3S — CID 143659840
3-bromo-N,N-bis[(4-methoxyphenyl)methyl]benzenesulfinamide (PubChem CID 143659840) has the molecular formula C22H22BrNO3S and a molecular weight of 460.39 g/mol. Its IUPAC name is 3-bromo-N,N-bis[(4-methoxyphenyl)methyl]benzenesulfinamide.
| Compound Name | 3-bromo-N,N-bis[(4-methoxyphenyl)methyl]benzenesulfinamide |
|---|---|
| PubChem CID | 143659840 |
| Molecular Formula | C22H22BrNO3S |
| Molecular Weight | 460.39 g/mol |
| Exact Mass | 459.05 |
| IUPAC Name | 3-bromo-N,N-bis[(4-methoxyphenyl)methyl]benzenesulfinamide |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)S(=O)c2cccc(Br)c2)cc1 |
| InChI | InChI=1S/C22H22BrNO3S/c1-26-20-10-6-17(7-11-20)15-24(16-18-8-12-21(27-2)13-9-18)28(25)22-5-3-4-19(23)14-22/h3-14H,15-16H2,1-2H3 |
| InChIKey | ZXXKWMBBTIXURC-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.39 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |