C21H20BrNO4S — CID 46023029
N-(3-bromophenyl)-3-methoxy-N-[(4-methoxyphenyl)methyl]benzenesulfonamide (PubChem CID 46023029) has the molecular formula C21H20BrNO4S and a molecular weight of 462.37 g/mol. Its IUPAC name is N-(3-bromophenyl)-3-methoxy-N-[(4-methoxyphenyl)methyl]benzenesulfonamide.
| Compound Name | N-(3-bromophenyl)-3-methoxy-N-[(4-methoxyphenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 46023029 |
| Molecular Formula | C21H20BrNO4S |
| Molecular Weight | 462.37 g/mol |
| Exact Mass | 461.03 |
| IUPAC Name | N-(3-bromophenyl)-3-methoxy-N-[(4-methoxyphenyl)methyl]benzenesulfonamide |
| SMILES | COc1ccc(CN(c2cccc(Br)c2)S(=O)(=O)c2cccc(OC)c2)cc1 |
| InChI | InChI=1S/C21H20BrNO4S/c1-26-19-11-9-16(10-12-19)15-23(18-6-3-5-17(22)13-18)28(24,25)21-8-4-7-20(14-21)27-2/h3-14H,15H2,1-2H3 |
| InChIKey | QARJVVYLXCFPGQ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.37 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |