C19H21N3O3S — CID 142587965
N,N-bis[(4-methoxyphenyl)methyl]-1H-pyrazole-4-sulfinamide (PubChem CID 142587965) has the molecular formula C19H21N3O3S and a molecular weight of 371.46 g/mol. Its IUPAC name is N,N-bis[(4-methoxyphenyl)methyl]-1H-pyrazole-4-sulfinamide.
| Compound Name | N,N-bis[(4-methoxyphenyl)methyl]-1H-pyrazole-4-sulfinamide |
|---|---|
| PubChem CID | 142587965 |
| Molecular Formula | C19H21N3O3S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | N,N-bis[(4-methoxyphenyl)methyl]-1H-pyrazole-4-sulfinamide |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)S(=O)c2cn[nH]c2)cc1 |
| InChI | InChI=1S/C19H21N3O3S/c1-24-17-7-3-15(4-8-17)13-22(26(23)19-11-20-21-12-19)14-16-5-9-18(25-2)10-6-16/h3-12H,13-14H2,1-2H3,(H,20,21) |
| InChIKey | XYQBYFVPTHUULK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |