C24H33NO3S — CID 137398696
N,N-bis[(4-methoxyphenyl)methyl]-4-methylhept-6-ene-3-sulfinamide (PubChem CID 137398696) has the molecular formula C24H33NO3S and a molecular weight of 415.60 g/mol. Its IUPAC name is N,N-bis[(4-methoxyphenyl)methyl]-4-methylhept-6-ene-3-sulfinamide.
| Compound Name | N,N-bis[(4-methoxyphenyl)methyl]-4-methylhept-6-ene-3-sulfinamide |
|---|---|
| PubChem CID | 137398696 |
| Molecular Formula | C24H33NO3S |
| Molecular Weight | 415.60 g/mol |
| Exact Mass | 415.22 |
| IUPAC Name | N,N-bis[(4-methoxyphenyl)methyl]-4-methylhept-6-ene-3-sulfinamide |
| SMILES | C=CCC(C)C(CC)S(=O)N(Cc1ccc(OC)cc1)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C24H33NO3S/c1-6-8-19(3)24(7-2)29(26)25(17-20-9-13-22(27-4)14-10-20)18-21-11-15-23(28-5)16-12-21/h6,9-16,19,24H,1,7-8,17-18H2,2-5H3 |
| InChIKey | NBUJEGFIZRAYIH-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.60 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|