C22H29NO5S — CID 118910363
(1R,2R)-1-hydroxy-N,N-bis[(4-methoxyphenyl)methyl]-2-methylpent-4-ene-1-sulfonamide (PubChem CID 118910363) has the molecular formula C22H29NO5S and a molecular weight of 419.54 g/mol. Its IUPAC name is (1R,2R)-1-hydroxy-N,N-bis[(4-methoxyphenyl)methyl]-2-methylpent-4-ene-1-sulfonamide.
| Compound Name | (1R,2R)-1-hydroxy-N,N-bis[(4-methoxyphenyl)methyl]-2-methylpent-4-ene-1-sulfonamide |
|---|---|
| PubChem CID | 118910363 |
| Molecular Formula | C22H29NO5S |
| Molecular Weight | 419.54 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | (1R,2R)-1-hydroxy-N,N-bis[(4-methoxyphenyl)methyl]-2-methylpent-4-ene-1-sulfonamide |
| SMILES | C=CC[C@@H](C)[C@H](O)S(=O)(=O)N(Cc1ccc(OC)cc1)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C22H29NO5S/c1-5-6-17(2)22(24)29(25,26)23(15-18-7-11-20(27-3)12-8-18)16-19-9-13-21(28-4)14-10-19/h5,7-14,17,22,24H,1,6,15-16H2,2-4H3/t17-,22-/m1/s1 |
| InChIKey | XQRIDIAPOFWKEJ-VGOFRKELSA-N |
| XLogP | 3.57 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.54 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|