C26H37NO6S — CID 166665248
(4S,5S)-9,9-dihydroxy-N,N-bis[(4-methoxyphenyl)methyl]-4-methylnon-1-ene-5-sulfonamide (PubChem CID 166665248) has the molecular formula C26H37NO6S and a molecular weight of 491.65 g/mol. Its IUPAC name is (4S,5S)-9,9-dihydroxy-N,N-bis[(4-methoxyphenyl)methyl]-4-methylnon-1-ene-5-sulfonamide.
| Compound Name | (4S,5S)-9,9-dihydroxy-N,N-bis[(4-methoxyphenyl)methyl]-4-methylnon-1-ene-5-sulfonamide |
|---|---|
| PubChem CID | 166665248 |
| Molecular Formula | C26H37NO6S |
| Molecular Weight | 491.65 g/mol |
| Exact Mass | 491.23 |
| IUPAC Name | (4S,5S)-9,9-dihydroxy-N,N-bis[(4-methoxyphenyl)methyl]-4-methylnon-1-ene-5-sulfonamide |
| SMILES | C=CC[C@H](C)[C@H](CCCC(O)O)S(=O)(=O)N(Cc1ccc(OC)cc1)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C26H37NO6S/c1-5-7-20(2)25(8-6-9-26(28)29)34(30,31)27(18-21-10-14-23(32-3)15-11-21)19-22-12-16-24(33-4)17-13-22/h5,10-17,20,25-26,28-29H,1,6-9,18-19H2,2-4H3/t20-,25-/m0/s1 |
| InChIKey | HAZCYVGFKWRGDK-CPJSRVTESA-N |
| XLogP | 4.10 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.65 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|