C26H35NO6S — CID 159417411
(2R,3S)-3-hydroxy-N,N-bis[(4-methoxyphenyl)methyl]-1-(oxolan-2-yl)hex-5-ene-2-sulfonamide (PubChem CID 159417411) has the molecular formula C26H35NO6S and a molecular weight of 489.63 g/mol. Its IUPAC name is (2R,3S)-3-hydroxy-N,N-bis[(4-methoxyphenyl)methyl]-1-(oxolan-2-yl)hex-5-ene-2-sulfonamide.
| Compound Name | (2R,3S)-3-hydroxy-N,N-bis[(4-methoxyphenyl)methyl]-1-(oxolan-2-yl)hex-5-ene-2-sulfonamide |
|---|---|
| PubChem CID | 159417411 |
| Molecular Formula | C26H35NO6S |
| Molecular Weight | 489.63 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | (2R,3S)-3-hydroxy-N,N-bis[(4-methoxyphenyl)methyl]-1-(oxolan-2-yl)hex-5-ene-2-sulfonamide |
| SMILES | C=CC[C@H](O)[C@@H](CC1CCCO1)S(=O)(=O)N(Cc1ccc(OC)cc1)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C26H35NO6S/c1-4-6-25(28)26(17-24-7-5-16-33-24)34(29,30)27(18-20-8-12-22(31-2)13-9-20)19-21-10-14-23(32-3)15-11-21/h4,8-15,24-26,28H,1,5-7,16-19H2,2-3H3/t24?,25-,26+/m0/s1 |
| InChIKey | PLCSHNHFLYOLOW-XBCLTQTASA-N |
| XLogP | 3.91 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.63 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|