C33H41NO7S — CID 166674631
[(2R,5S)-4-[bis[(4-methoxyphenyl)methyl]sulfamoyl]-1-methoxy-5-methyloct-7-en-2-yl] benzoate (PubChem CID 166674631) has the molecular formula C33H41NO7S and a molecular weight of 595.76 g/mol. Its IUPAC name is [(2R,5S)-4-[bis[(4-methoxyphenyl)methyl]sulfamoyl]-1-methoxy-5-methyloct-7-en-2-yl] benzoate.
| Compound Name | [(2R,5S)-4-[bis[(4-methoxyphenyl)methyl]sulfamoyl]-1-methoxy-5-methyloct-7-en-2-yl] benzoate |
|---|---|
| PubChem CID | 166674631 |
| Molecular Formula | C33H41NO7S |
| Molecular Weight | 595.76 g/mol |
| Exact Mass | 595.26 |
| IUPAC Name | [(2R,5S)-4-[bis[(4-methoxyphenyl)methyl]sulfamoyl]-1-methoxy-5-methyloct-7-en-2-yl] benzoate |
| SMILES | C=CC[C@H](C)C(C[C@H](COC)OC(=O)c1ccccc1)S(=O)(=O)N(Cc1ccc(OC)cc1)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C33H41NO7S/c1-6-10-25(2)32(21-31(24-38-3)41-33(35)28-11-8-7-9-12-28)42(36,37)34(22-26-13-17-29(39-4)18-14-26)23-27-15-19-30(40-5)20-16-27/h6-9,11-20,25,31-32H,1,10,21-24H2,2-5H3/t25-,31+,32?/m0/s1 |
| InChIKey | WPSYLGAFXJOYLD-VRGWCOAZSA-N |
| XLogP | 5.88 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.76 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|