C27H37NO6S — CID 130367530
propan-2-yl (3S,4R)-3-[bis[(4-methoxyphenyl)methyl]sulfamoyl]-4-methylhept-6-enoate (PubChem CID 130367530) has the molecular formula C27H37NO6S and a molecular weight of 503.66 g/mol. Its IUPAC name is propan-2-yl (3S,4R)-3-[bis[(4-methoxyphenyl)methyl]sulfamoyl]-4-methylhept-6-enoate.
| Compound Name | propan-2-yl (3S,4R)-3-[bis[(4-methoxyphenyl)methyl]sulfamoyl]-4-methylhept-6-enoate |
|---|---|
| PubChem CID | 130367530 |
| Molecular Formula | C27H37NO6S |
| Molecular Weight | 503.66 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | propan-2-yl (3S,4R)-3-[bis[(4-methoxyphenyl)methyl]sulfamoyl]-4-methylhept-6-enoate |
| SMILES | C=CC[C@@H](C)[C@H](CC(=O)OC(C)C)S(=O)(=O)N(Cc1ccc(OC)cc1)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C27H37NO6S/c1-7-8-21(4)26(17-27(29)34-20(2)3)35(30,31)28(18-22-9-13-24(32-5)14-10-22)19-23-11-15-25(33-6)16-12-23/h7,9-16,20-21,26H,1,8,17-19H2,2-6H3/t21-,26+/m1/s1 |
| InChIKey | WOLKIQKVQPFNKK-RLWLMLJZSA-N |
| XLogP | 4.96 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.66 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|