C21H27NO4S — CID 118903716
(2S)-N,N-bis[(4-methoxyphenyl)methyl]pent-4-ene-2-sulfonamide (PubChem CID 118903716) has the molecular formula C21H27NO4S and a molecular weight of 389.52 g/mol. Its IUPAC name is (2S)-N,N-bis[(4-methoxyphenyl)methyl]pent-4-ene-2-sulfonamide.
| Compound Name | (2S)-N,N-bis[(4-methoxyphenyl)methyl]pent-4-ene-2-sulfonamide |
|---|---|
| PubChem CID | 118903716 |
| Molecular Formula | C21H27NO4S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | (2S)-N,N-bis[(4-methoxyphenyl)methyl]pent-4-ene-2-sulfonamide |
| SMILES | C=CC[C@H](C)S(=O)(=O)N(Cc1ccc(OC)cc1)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C21H27NO4S/c1-5-6-17(2)27(23,24)22(15-18-7-11-20(25-3)12-8-18)16-19-9-13-21(26-4)14-10-19/h5,7-14,17H,1,6,15-16H2,2-4H3/t17-/m0/s1 |
| InChIKey | WGOXONCDANBNEV-KRWDZBQOSA-N |
| XLogP | 4.00 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|