C22H29NO6S — CID 145359334
methyl (2R)-2-[bis[(4-methoxyphenyl)methyl]sulfamoyl]-3-methylbutanoate (PubChem CID 145359334) has the molecular formula C22H29NO6S and a molecular weight of 435.54 g/mol. Its IUPAC name is methyl (2R)-2-[bis[(4-methoxyphenyl)methyl]sulfamoyl]-3-methylbutanoate.
| Compound Name | methyl (2R)-2-[bis[(4-methoxyphenyl)methyl]sulfamoyl]-3-methylbutanoate |
|---|---|
| PubChem CID | 145359334 |
| Molecular Formula | C22H29NO6S |
| Molecular Weight | 435.54 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | methyl (2R)-2-[bis[(4-methoxyphenyl)methyl]sulfamoyl]-3-methylbutanoate |
| SMILES | COC(=O)[C@@H](C(C)C)S(=O)(=O)N(Cc1ccc(OC)cc1)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C22H29NO6S/c1-16(2)21(22(24)29-5)30(25,26)23(14-17-6-10-19(27-3)11-7-17)15-18-8-12-20(28-4)13-9-18/h6-13,16,21H,14-15H2,1-5H3/t21-/m1/s1 |
| InChIKey | AZOICZRLLYKIRZ-OAQYLSRUSA-N |
| XLogP | 3.23 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.54 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |