C22H29NO5S — CID 170936388
N,N-bis[(4-methoxyphenyl)methyl]-3-methyl-5-oxopentane-2-sulfonamide (PubChem CID 170936388) has the molecular formula C22H29NO5S and a molecular weight of 419.54 g/mol. Its IUPAC name is N,N-bis[(4-methoxyphenyl)methyl]-3-methyl-5-oxopentane-2-sulfonamide.
| Compound Name | N,N-bis[(4-methoxyphenyl)methyl]-3-methyl-5-oxopentane-2-sulfonamide |
|---|---|
| PubChem CID | 170936388 |
| Molecular Formula | C22H29NO5S |
| Molecular Weight | 419.54 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | N,N-bis[(4-methoxyphenyl)methyl]-3-methyl-5-oxopentane-2-sulfonamide |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)S(=O)(=O)C(C)C(C)CC=O)cc1 |
| InChI | InChI=1S/C22H29NO5S/c1-17(13-14-24)18(2)29(25,26)23(15-19-5-9-21(27-3)10-6-19)16-20-7-11-22(28-4)12-8-20/h5-12,14,17-18H,13,15-16H2,1-4H3 |
| InChIKey | XAVFAMLTPIRBGY-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.54 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|