C25H35NO5S — CID 130367372
(4R)-2-hydroxy-N,N-bis[(4-methoxyphenyl)methyl]-2-methyloct-7-ene-4-sulfonamide (PubChem CID 130367372) has the molecular formula C25H35NO5S and a molecular weight of 461.62 g/mol. Its IUPAC name is (4R)-2-hydroxy-N,N-bis[(4-methoxyphenyl)methyl]-2-methyloct-7-ene-4-sulfonamide.
| Compound Name | (4R)-2-hydroxy-N,N-bis[(4-methoxyphenyl)methyl]-2-methyloct-7-ene-4-sulfonamide |
|---|---|
| PubChem CID | 130367372 |
| Molecular Formula | C25H35NO5S |
| Molecular Weight | 461.62 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | (4R)-2-hydroxy-N,N-bis[(4-methoxyphenyl)methyl]-2-methyloct-7-ene-4-sulfonamide |
| SMILES | C=CCC[C@H](CC(C)(C)O)S(=O)(=O)N(Cc1ccc(OC)cc1)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C25H35NO5S/c1-6-7-8-24(17-25(2,3)27)32(28,29)26(18-20-9-13-22(30-4)14-10-20)19-21-11-15-23(31-5)16-12-21/h6,9-16,24,27H,1,7-8,17-19H2,2-5H3/t24-/m1/s1 |
| InChIKey | DGQAMAZZSOBOLE-XMMPIXPASA-N |
| XLogP | 4.53 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.62 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|