C27H32N2O4S — CID 130367447
(2R)-N,N-bis[(4-methoxyphenyl)methyl]-1-pyridin-2-ylhex-5-ene-2-sulfonamide (PubChem CID 130367447) has the molecular formula C27H32N2O4S and a molecular weight of 480.63 g/mol. Its IUPAC name is (2R)-N,N-bis[(4-methoxyphenyl)methyl]-1-pyridin-2-ylhex-5-ene-2-sulfonamide.
| Compound Name | (2R)-N,N-bis[(4-methoxyphenyl)methyl]-1-pyridin-2-ylhex-5-ene-2-sulfonamide |
|---|---|
| PubChem CID | 130367447 |
| Molecular Formula | C27H32N2O4S |
| Molecular Weight | 480.63 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | (2R)-N,N-bis[(4-methoxyphenyl)methyl]-1-pyridin-2-ylhex-5-ene-2-sulfonamide |
| SMILES | C=CCC[C@H](Cc1ccccn1)S(=O)(=O)N(Cc1ccc(OC)cc1)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C27H32N2O4S/c1-4-5-9-27(19-24-8-6-7-18-28-24)34(30,31)29(20-22-10-14-25(32-2)15-11-22)21-23-12-16-26(33-3)17-13-23/h4,6-8,10-18,27H,1,5,9,19-21H2,2-3H3/t27-/m1/s1 |
| InChIKey | WPHLCQAFZJROPT-HHHXNRCGSA-N |
| XLogP | 5.01 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.63 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|