C24H33NO5S — CID 130367829
2-hydroxy-N,N-bis[(4-methoxyphenyl)methyl]-2-methylhept-6-ene-3-sulfonamide (PubChem CID 130367829) has the molecular formula C24H33NO5S and a molecular weight of 447.60 g/mol. Its IUPAC name is 2-hydroxy-N,N-bis[(4-methoxyphenyl)methyl]-2-methylhept-6-ene-3-sulfonamide.
| Compound Name | 2-hydroxy-N,N-bis[(4-methoxyphenyl)methyl]-2-methylhept-6-ene-3-sulfonamide |
|---|---|
| PubChem CID | 130367829 |
| Molecular Formula | C24H33NO5S |
| Molecular Weight | 447.60 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | 2-hydroxy-N,N-bis[(4-methoxyphenyl)methyl]-2-methylhept-6-ene-3-sulfonamide |
| SMILES | C=CCCC(C(C)(C)O)S(=O)(=O)N(Cc1ccc(OC)cc1)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C24H33NO5S/c1-6-7-8-23(24(2,3)26)31(27,28)25(17-19-9-13-21(29-4)14-10-19)18-20-11-15-22(30-5)16-12-20/h6,9-16,23,26H,1,7-8,17-18H2,2-5H3 |
| InChIKey | BGJMVRDRTLFARO-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.60 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|