C26H30N2O4S — CID 130367308
N,N-bis[(4-methoxyphenyl)methyl]-1-pyridin-2-ylpent-4-ene-1-sulfonamide (PubChem CID 130367308) has the molecular formula C26H30N2O4S and a molecular weight of 466.60 g/mol. Its IUPAC name is N,N-bis[(4-methoxyphenyl)methyl]-1-pyridin-2-ylpent-4-ene-1-sulfonamide.
| Compound Name | N,N-bis[(4-methoxyphenyl)methyl]-1-pyridin-2-ylpent-4-ene-1-sulfonamide |
|---|---|
| PubChem CID | 130367308 |
| Molecular Formula | C26H30N2O4S |
| Molecular Weight | 466.60 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | N,N-bis[(4-methoxyphenyl)methyl]-1-pyridin-2-ylpent-4-ene-1-sulfonamide |
| SMILES | C=CCCC(c1ccccn1)S(=O)(=O)N(Cc1ccc(OC)cc1)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C26H30N2O4S/c1-4-5-9-26(25-8-6-7-18-27-25)33(29,30)28(19-21-10-14-23(31-2)15-11-21)20-22-12-16-24(32-3)17-13-22/h4,6-8,10-18,26H,1,5,9,19-20H2,2-3H3 |
| InChIKey | OEKIDPTXRMQDBK-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.60 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|