C25H34N2O5S — CID 162473194
(2S)-N-[bis[(4-methoxyphenyl)methyl]sulfamoyl]-N-(oxolan-2-ylmethyl)but-3-en-2-amine (PubChem CID 162473194) has the molecular formula C25H34N2O5S and a molecular weight of 474.62 g/mol. Its IUPAC name is (2S)-N-[bis[(4-methoxyphenyl)methyl]sulfamoyl]-N-(oxolan-2-ylmethyl)but-3-en-2-amine.
| Compound Name | (2S)-N-[bis[(4-methoxyphenyl)methyl]sulfamoyl]-N-(oxolan-2-ylmethyl)but-3-en-2-amine |
|---|---|
| PubChem CID | 162473194 |
| Molecular Formula | C25H34N2O5S |
| Molecular Weight | 474.62 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | (2S)-N-[bis[(4-methoxyphenyl)methyl]sulfamoyl]-N-(oxolan-2-ylmethyl)but-3-en-2-amine |
| SMILES | C=C[C@H](C)N(CC1CCCO1)S(=O)(=O)N(Cc1ccc(OC)cc1)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C25H34N2O5S/c1-5-20(2)27(19-25-7-6-16-32-25)33(28,29)26(17-21-8-12-23(30-3)13-9-21)18-22-10-14-24(31-4)15-11-22/h5,8-15,20,25H,1,6-7,16-19H2,2-4H3/t20-,25?/m0/s1 |
| InChIKey | VJVZKYFVKYNJOT-JINQPTGOSA-N |
| XLogP | 4.01 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.62 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|