C18H25NO4 — CID 94815353
4-methoxy-N,N-bis[[(2S)-oxolan-2-yl]methyl]benzamide (PubChem CID 94815353) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is 4-methoxy-N,N-bis[[(2S)-oxolan-2-yl]methyl]benzamide.
| Compound Name | 4-methoxy-N,N-bis[[(2S)-oxolan-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 94815353 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | 4-methoxy-N,N-bis[[(2S)-oxolan-2-yl]methyl]benzamide |
| SMILES | COc1ccc(C(=O)N(C[C@@H]2CCCO2)C[C@@H]2CCCO2)cc1 |
| InChI | InChI=1S/C18H25NO4/c1-21-15-8-6-14(7-9-15)18(20)19(12-16-4-2-10-22-16)13-17-5-3-11-23-17/h6-9,16-17H,2-5,10-13H2,1H3/t16-,17-/m0/s1 |
| InChIKey | LUUHCUWRNFRANB-IRXDYDNUSA-N |
| XLogP | 2.50 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |