C18H22N2O3 — CID 94817152
4-cyano-N-[[(2R)-oxolan-2-yl]methyl]-N-[[(2S)-oxolan-2-yl]methyl]benzamide (PubChem CID 94817152) has the molecular formula C18H22N2O3 and a molecular weight of 314.38 g/mol. Its IUPAC name is 4-cyano-N-[[(2R)-oxolan-2-yl]methyl]-N-[[(2S)-oxolan-2-yl]methyl]benzamide.
| Compound Name | 4-cyano-N-[[(2R)-oxolan-2-yl]methyl]-N-[[(2S)-oxolan-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 94817152 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 4-cyano-N-[[(2R)-oxolan-2-yl]methyl]-N-[[(2S)-oxolan-2-yl]methyl]benzamide |
| SMILES | N#Cc1ccc(C(=O)N(C[C@H]2CCCO2)C[C@@H]2CCCO2)cc1 |
| InChI | InChI=1S/C18H22N2O3/c19-11-14-5-7-15(8-6-14)18(21)20(12-16-3-1-9-22-16)13-17-4-2-10-23-17/h5-8,16-17H,1-4,9-10,12-13H2/t16-,17+ |
| InChIKey | QUUACARONJCEQV-CALCHBBNSA-N |
| XLogP | 2.36 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |