C25H34N2O3S — CID 101262200
N-benzyl-N-[[(2R)-but-3-en-2-yl]-[(4-methoxyphenyl)methyl]sulfamoyl]-4-methylpent-1-en-3-amine (PubChem CID 101262200) has the molecular formula C25H34N2O3S and a molecular weight of 442.63 g/mol. Its IUPAC name is N-benzyl-N-[[(2R)-but-3-en-2-yl]-[(4-methoxyphenyl)methyl]sulfamoyl]-4-methylpent-1-en-3-amine.
| Compound Name | N-benzyl-N-[[(2R)-but-3-en-2-yl]-[(4-methoxyphenyl)methyl]sulfamoyl]-4-methylpent-1-en-3-amine |
|---|---|
| PubChem CID | 101262200 |
| Molecular Formula | C25H34N2O3S |
| Molecular Weight | 442.63 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | N-benzyl-N-[[(2R)-but-3-en-2-yl]-[(4-methoxyphenyl)methyl]sulfamoyl]-4-methylpent-1-en-3-amine |
| SMILES | C=CC(C(C)C)N(Cc1ccccc1)S(=O)(=O)N(Cc1ccc(OC)cc1)[C@H](C)C=C |
| InChI | InChI=1S/C25H34N2O3S/c1-7-21(5)26(18-23-14-16-24(30-6)17-15-23)31(28,29)27(25(8-2)20(3)4)19-22-12-10-9-11-13-22/h7-17,20-21,25H,1-2,18-19H2,3-6H3/t21-,25?/m1/s1 |
| InChIKey | JNHNOQWDDZBIAK-JGKWMGOWSA-N |
| XLogP | 5.03 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.63 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|