C24H32N2O6S — CID 175237743
anisole;methyl 4-[[(1-amino-3-methyl-1-oxobutan-2-yl)-prop-2-enylsulfonylamino]methyl]benzoate (PubChem CID 175237743) has the molecular formula C24H32N2O6S and a molecular weight of 476.60 g/mol. Its IUPAC name is anisole;methyl 4-[[(1-amino-3-methyl-1-oxobutan-2-yl)-prop-2-enylsulfonylamino]methyl]benzoate.
| Compound Name | anisole;methyl 4-[[(1-amino-3-methyl-1-oxobutan-2-yl)-prop-2-enylsulfonylamino]methyl]benzoate |
|---|---|
| PubChem CID | 175237743 |
| Molecular Formula | C24H32N2O6S |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | anisole;methyl 4-[[(1-amino-3-methyl-1-oxobutan-2-yl)-prop-2-enylsulfonylamino]methyl]benzoate |
| SMILES | C=CCS(=O)(=O)N(Cc1ccc(C(=O)OC)cc1)C(C(N)=O)C(C)C.COc1ccccc1 |
| InChI | InChI=1S/C17H24N2O5S.C7H8O/c1-5-10-25(22,23)19(15(12(2)3)16(18)20)11-13-6-8-14(9-7-13)17(21)24-4;1-8-7-5-3-2-4-6-7/h5-9,12,15H,1,10-11H2,2-4H3,(H2,18,20);2-6H,1H3 |
| InChIKey | UEMNDHVGWMOTHX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 116.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|