C21H28N2O6S — CID 174389227
anisole;methyl 2-[(2-aminophenyl)methyl-prop-2-enylsulfonylamino]-3-hydroxypropanoate (PubChem CID 174389227) has the molecular formula C21H28N2O6S and a molecular weight of 436.53 g/mol. Its IUPAC name is anisole;methyl 2-[(2-aminophenyl)methyl-prop-2-enylsulfonylamino]-3-hydroxypropanoate.
| Compound Name | anisole;methyl 2-[(2-aminophenyl)methyl-prop-2-enylsulfonylamino]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 174389227 |
| Molecular Formula | C21H28N2O6S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | anisole;methyl 2-[(2-aminophenyl)methyl-prop-2-enylsulfonylamino]-3-hydroxypropanoate |
| SMILES | C=CCS(=O)(=O)N(Cc1ccccc1N)C(CO)C(=O)OC.COc1ccccc1 |
| InChI | InChI=1S/C14H20N2O5S.C7H8O/c1-3-8-22(19,20)16(13(10-17)14(18)21-2)9-11-6-4-5-7-12(11)15;1-8-7-5-3-2-4-6-7/h3-7,13,17H,1,8-10,15H2,2H3;2-6H,1H3 |
| InChIKey | IEJBPQPBZOBFIA-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 119.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|