C17H25NO5S — CID 174322747
methyl 2-[butyl(prop-2-enylsulfonyl)amino]-3-(4-hydroxyphenyl)propanoate (PubChem CID 174322747) has the molecular formula C17H25NO5S and a molecular weight of 355.46 g/mol. Its IUPAC name is methyl 2-[butyl(prop-2-enylsulfonyl)amino]-3-(4-hydroxyphenyl)propanoate.
| Compound Name | methyl 2-[butyl(prop-2-enylsulfonyl)amino]-3-(4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 174322747 |
| Molecular Formula | C17H25NO5S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | methyl 2-[butyl(prop-2-enylsulfonyl)amino]-3-(4-hydroxyphenyl)propanoate |
| SMILES | C=CCS(=O)(=O)N(CCCC)C(Cc1ccc(O)cc1)C(=O)OC |
| InChI | InChI=1S/C17H25NO5S/c1-4-6-11-18(24(21,22)12-5-2)16(17(20)23-3)13-14-7-9-15(19)10-8-14/h5,7-10,16,19H,2,4,6,11-13H2,1,3H3 |
| InChIKey | GKFHWOPMDIJLLP-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|