C14H17NO3 — CID 56601958
methyl (2S)-3-(4-hydroxyphenyl)-2-[methyl(prop-2-ynyl)amino]propanoate (PubChem CID 56601958) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is methyl (2S)-3-(4-hydroxyphenyl)-2-[methyl(prop-2-ynyl)amino]propanoate.
| Compound Name | methyl (2S)-3-(4-hydroxyphenyl)-2-[methyl(prop-2-ynyl)amino]propanoate |
|---|---|
| PubChem CID | 56601958 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | methyl (2S)-3-(4-hydroxyphenyl)-2-[methyl(prop-2-ynyl)amino]propanoate |
| SMILES | C#CCN(C)[C@@H](Cc1ccc(O)cc1)C(=O)OC |
| InChI | InChI=1S/C14H17NO3/c1-4-9-15(2)13(14(17)18-3)10-11-5-7-12(16)8-6-11/h1,5-8,13,16H,9-10H2,2-3H3/t13-/m0/s1 |
| InChIKey | XCIQNYPRAPUTDN-ZDUSSCGKSA-N |
| XLogP | 1.04 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|