C12H12Cl2F3NO4 — CID 141073623
methyl (2S)-2-[chloro-(2,2,2-trifluoroacetyl)amino]-3-(4-hydroxyphenyl)propanoate;hydrochloride (PubChem CID 141073623) has the molecular formula C12H12Cl2F3NO4 and a molecular weight of 362.13 g/mol. Its IUPAC name is methyl (2S)-2-[chloro-(2,2,2-trifluoroacetyl)amino]-3-(4-hydroxyphenyl)propanoate;hydrochloride.
| Compound Name | methyl (2S)-2-[chloro-(2,2,2-trifluoroacetyl)amino]-3-(4-hydroxyphenyl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 141073623 |
| Molecular Formula | C12H12Cl2F3NO4 |
| Molecular Weight | 362.13 g/mol |
| Exact Mass | 361.01 |
| IUPAC Name | methyl (2S)-2-[chloro-(2,2,2-trifluoroacetyl)amino]-3-(4-hydroxyphenyl)propanoate;hydrochloride |
| SMILES | COC(=O)[C@H](Cc1ccc(O)cc1)N(Cl)C(=O)C(F)(F)F.Cl |
| InChI | InChI=1S/C12H11ClF3NO4.ClH/c1-21-10(19)9(17(13)11(20)12(14,15)16)6-7-2-4-8(18)5-3-7;/h2-5,9,18H,6H2,1H3;1H/t9-;/m0./s1 |
| InChIKey | MLJZQAZVRZGQEC-FVGYRXGTSA-N |
| XLogP | 2.44 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.13 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|