C16H25NO5S — CID 174298948
butane;3-(4-hydroxyphenyl)-2-(prop-2-enylsulfonylamino)propanoic acid (PubChem CID 174298948) has the molecular formula C16H25NO5S and a molecular weight of 343.45 g/mol. Its IUPAC name is butane;3-(4-hydroxyphenyl)-2-(prop-2-enylsulfonylamino)propanoic acid.
| Compound Name | butane;3-(4-hydroxyphenyl)-2-(prop-2-enylsulfonylamino)propanoic acid |
|---|---|
| PubChem CID | 174298948 |
| Molecular Formula | C16H25NO5S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | butane;3-(4-hydroxyphenyl)-2-(prop-2-enylsulfonylamino)propanoic acid |
| SMILES | C=CCS(=O)(=O)NC(Cc1ccc(O)cc1)C(=O)O.CCCC |
| InChI | InChI=1S/C12H15NO5S.C4H10/c1-2-7-19(17,18)13-11(12(15)16)8-9-3-5-10(14)6-4-9;1-3-4-2/h2-6,11,13-14H,1,7-8H2,(H,15,16);3-4H2,1-2H3 |
| InChIKey | CMKCRIIUQSBDSF-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|