C16H17NO5S — CID 69341011
(2S)-3-(4-hydroxyphenyl)-2-[(2-methylphenyl)sulfonylamino]propanoic acid (PubChem CID 69341011) has the molecular formula C16H17NO5S and a molecular weight of 335.38 g/mol. Its IUPAC name is (2S)-3-(4-hydroxyphenyl)-2-[(2-methylphenyl)sulfonylamino]propanoic acid.
| Compound Name | (2S)-3-(4-hydroxyphenyl)-2-[(2-methylphenyl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 69341011 |
| Molecular Formula | C16H17NO5S |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | (2S)-3-(4-hydroxyphenyl)-2-[(2-methylphenyl)sulfonylamino]propanoic acid |
| SMILES | Cc1ccccc1S(=O)(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C16H17NO5S/c1-11-4-2-3-5-15(11)23(21,22)17-14(16(19)20)10-12-6-8-13(18)9-7-12/h2-9,14,17-18H,10H2,1H3,(H,19,20)/t14-/m0/s1 |
| InChIKey | WIMMVSQPTCPDTD-AWEZNQCLSA-N |
| XLogP | 1.67 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |