C16H15F2NO5S — CID 167790252
(2S)-2-[[4-(difluoromethyl)phenyl]sulfonylamino]-3-(4-hydroxyphenyl)propanoic acid (PubChem CID 167790252) has the molecular formula C16H15F2NO5S and a molecular weight of 371.36 g/mol. Its IUPAC name is (2S)-2-[[4-(difluoromethyl)phenyl]sulfonylamino]-3-(4-hydroxyphenyl)propanoic acid.
| Compound Name | (2S)-2-[[4-(difluoromethyl)phenyl]sulfonylamino]-3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 167790252 |
| Molecular Formula | C16H15F2NO5S |
| Molecular Weight | 371.36 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | (2S)-2-[[4-(difluoromethyl)phenyl]sulfonylamino]-3-(4-hydroxyphenyl)propanoic acid |
| SMILES | O=C(O)[C@H](Cc1ccc(O)cc1)NS(=O)(=O)c1ccc(C(F)F)cc1 |
| InChI | InChI=1S/C16H15F2NO5S/c17-15(18)11-3-7-13(8-4-11)25(23,24)19-14(16(21)22)9-10-1-5-12(20)6-2-10/h1-8,14-15,19-20H,9H2,(H,21,22)/t14-/m0/s1 |
| InChIKey | RKPSTNQFKBWBMQ-AWEZNQCLSA-N |
| XLogP | 2.30 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.36 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |