C21H17NO6S2 — CID 23297841
3-(4-hydroxyphenyl)-2-(phenoxathiin-2-ylsulfonylamino)propanoic acid (PubChem CID 23297841) has the molecular formula C21H17NO6S2 and a molecular weight of 443.50 g/mol. Its IUPAC name is 3-(4-hydroxyphenyl)-2-(phenoxathiin-2-ylsulfonylamino)propanoic acid.
| Compound Name | 3-(4-hydroxyphenyl)-2-(phenoxathiin-2-ylsulfonylamino)propanoic acid |
|---|---|
| PubChem CID | 23297841 |
| Molecular Formula | C21H17NO6S2 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.05 |
| IUPAC Name | 3-(4-hydroxyphenyl)-2-(phenoxathiin-2-ylsulfonylamino)propanoic acid |
| SMILES | O=C(O)C(Cc1ccc(O)cc1)NS(=O)(=O)c1ccc2c(c1)Sc1ccccc1O2 |
| InChI | InChI=1S/C21H17NO6S2/c23-14-7-5-13(6-8-14)11-16(21(24)25)22-30(26,27)15-9-10-18-20(12-15)29-19-4-2-1-3-17(19)28-18/h1-10,12,16,22-23H,11H2,(H,24,25) |
| InChIKey | SVLAQNJLQOWKGL-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |