C22H19NO5S2 — CID 15487605
(2S)-2-(phenoxathiin-2-ylsulfonylamino)-4-phenylbutanoic acid (PubChem CID 15487605) has the molecular formula C22H19NO5S2 and a molecular weight of 441.53 g/mol. Its IUPAC name is (2S)-2-(phenoxathiin-2-ylsulfonylamino)-4-phenylbutanoic acid.
| Compound Name | (2S)-2-(phenoxathiin-2-ylsulfonylamino)-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 15487605 |
| Molecular Formula | C22H19NO5S2 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.07 |
| IUPAC Name | (2S)-2-(phenoxathiin-2-ylsulfonylamino)-4-phenylbutanoic acid |
| SMILES | O=C(O)[C@H](CCc1ccccc1)NS(=O)(=O)c1ccc2c(c1)Sc1ccccc1O2 |
| InChI | InChI=1S/C22H19NO5S2/c24-22(25)17(12-10-15-6-2-1-3-7-15)23-30(26,27)16-11-13-19-21(14-16)29-20-9-5-4-8-18(20)28-19/h1-9,11,13-14,17,23H,10,12H2,(H,24,25)/t17-/m0/s1 |
| InChIKey | TXMAYGLFMDYBJM-KRWDZBQOSA-N |
| XLogP | 4.31 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |