C22H20N2O5S2 — CID 57189998
2-[[1-(hydroxyamino)-1-oxo-4-phenylbutan-2-yl]-sulfinoamino]phenoxathiine (PubChem CID 57189998) has the molecular formula C22H20N2O5S2 and a molecular weight of 456.55 g/mol. Its IUPAC name is 2-[[1-(hydroxyamino)-1-oxo-4-phenylbutan-2-yl]-sulfinoamino]phenoxathiine.
| Compound Name | 2-[[1-(hydroxyamino)-1-oxo-4-phenylbutan-2-yl]-sulfinoamino]phenoxathiine |
|---|---|
| PubChem CID | 57189998 |
| Molecular Formula | C22H20N2O5S2 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | 2-[[1-(hydroxyamino)-1-oxo-4-phenylbutan-2-yl]-sulfinoamino]phenoxathiine |
| SMILES | O=C(NO)C(CCc1ccccc1)N(c1ccc2c(c1)Sc1ccccc1O2)S(=O)O |
| InChI | InChI=1S/C22H20N2O5S2/c25-22(23-26)17(12-10-15-6-2-1-3-7-15)24(31(27)28)16-11-13-19-21(14-16)30-20-9-5-4-8-18(20)29-19/h1-9,11,13-14,17,26H,10,12H2,(H,23,25)(H,27,28) |
| InChIKey | QEYOFNUICIOBGQ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|