C23H25NO5S — CID 56974955
5-phenyl-2-[sulfino(6,7,8,9-tetrahydrodibenzofuran-3-yl)amino]pentanoic acid (PubChem CID 56974955) has the molecular formula C23H25NO5S and a molecular weight of 427.52 g/mol. Its IUPAC name is 5-phenyl-2-[sulfino(6,7,8,9-tetrahydrodibenzofuran-3-yl)amino]pentanoic acid.
| Compound Name | 5-phenyl-2-[sulfino(6,7,8,9-tetrahydrodibenzofuran-3-yl)amino]pentanoic acid |
|---|---|
| PubChem CID | 56974955 |
| Molecular Formula | C23H25NO5S |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | 5-phenyl-2-[sulfino(6,7,8,9-tetrahydrodibenzofuran-3-yl)amino]pentanoic acid |
| SMILES | O=C(O)C(CCCc1ccccc1)N(c1ccc2c3c(oc2c1)CCCC3)S(=O)O |
| InChI | InChI=1S/C23H25NO5S/c25-23(26)20(11-6-9-16-7-2-1-3-8-16)24(30(27)28)17-13-14-19-18-10-4-5-12-21(18)29-22(19)15-17/h1-3,7-8,13-15,20H,4-6,9-12H2,(H,25,26)(H,27,28) |
| InChIKey | HDFCUIMUPAZZIJ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|