C22H24N2O7S2 — CID 18386315
4-(phenylsulfamoyl)-2-(6,7,8,9-tetrahydrodibenzofuran-3-ylsulfonylamino)butanoic acid (PubChem CID 18386315) has the molecular formula C22H24N2O7S2 and a molecular weight of 492.58 g/mol. Its IUPAC name is 4-(phenylsulfamoyl)-2-(6,7,8,9-tetrahydrodibenzofuran-3-ylsulfonylamino)butanoic acid.
| Compound Name | 4-(phenylsulfamoyl)-2-(6,7,8,9-tetrahydrodibenzofuran-3-ylsulfonylamino)butanoic acid |
|---|---|
| PubChem CID | 18386315 |
| Molecular Formula | C22H24N2O7S2 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.10 |
| IUPAC Name | 4-(phenylsulfamoyl)-2-(6,7,8,9-tetrahydrodibenzofuran-3-ylsulfonylamino)butanoic acid |
| SMILES | O=C(O)C(CCS(=O)(=O)Nc1ccccc1)NS(=O)(=O)c1ccc2c3c(oc2c1)CCCC3 |
| InChI | InChI=1S/C22H24N2O7S2/c25-22(26)19(12-13-32(27,28)23-15-6-2-1-3-7-15)24-33(29,30)16-10-11-18-17-8-4-5-9-20(17)31-21(18)14-16/h1-3,6-7,10-11,14,19,23-24H,4-5,8-9,12-13H2,(H,25,26) |
| InChIKey | HNEFGOMOYFKACW-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 142.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |