C16H15NO5S2 — CID 23288344
2-(dibenzofuran-2-ylsulfonylamino)-4-sulfanylbutanoic acid (PubChem CID 23288344) has the molecular formula C16H15NO5S2 and a molecular weight of 365.43 g/mol. Its IUPAC name is 2-(dibenzofuran-2-ylsulfonylamino)-4-sulfanylbutanoic acid.
| Compound Name | 2-(dibenzofuran-2-ylsulfonylamino)-4-sulfanylbutanoic acid |
|---|---|
| PubChem CID | 23288344 |
| Molecular Formula | C16H15NO5S2 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.04 |
| IUPAC Name | 2-(dibenzofuran-2-ylsulfonylamino)-4-sulfanylbutanoic acid |
| SMILES | O=C(O)C(CCS)NS(=O)(=O)c1ccc2oc3ccccc3c2c1 |
| InChI | InChI=1S/C16H15NO5S2/c18-16(19)13(7-8-23)17-24(20,21)10-5-6-15-12(9-10)11-3-1-2-4-14(11)22-15/h1-6,9,13,17,23H,7-8H2,(H,18,19) |
| InChIKey | NOYWCELMDAGFET-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|