C18H18FNO5S — CID 166666861
2-(dibenzofuran-2-ylsulfonylamino)-4-fluoro-4-methylpentanoic acid (PubChem CID 166666861) has the molecular formula C18H18FNO5S and a molecular weight of 379.41 g/mol. Its IUPAC name is 2-(dibenzofuran-2-ylsulfonylamino)-4-fluoro-4-methylpentanoic acid.
| Compound Name | 2-(dibenzofuran-2-ylsulfonylamino)-4-fluoro-4-methylpentanoic acid |
|---|---|
| PubChem CID | 166666861 |
| Molecular Formula | C18H18FNO5S |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | 2-(dibenzofuran-2-ylsulfonylamino)-4-fluoro-4-methylpentanoic acid |
| SMILES | CC(C)(F)CC(NS(=O)(=O)c1ccc2oc3ccccc3c2c1)C(=O)O |
| InChI | InChI=1S/C18H18FNO5S/c1-18(2,19)10-14(17(21)22)20-26(23,24)11-7-8-16-13(9-11)12-5-3-4-6-15(12)25-16/h3-9,14,20H,10H2,1-2H3,(H,21,22) |
| InChIKey | QOWRDVGRIWTYGE-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |