C16H13NO7S — CID 141017674
(2S)-2-(dibenzofuran-2-ylsulfonylamino)butanedioic acid (PubChem CID 141017674) has the molecular formula C16H13NO7S and a molecular weight of 363.35 g/mol. Its IUPAC name is (2S)-2-(dibenzofuran-2-ylsulfonylamino)butanedioic acid.
| Compound Name | (2S)-2-(dibenzofuran-2-ylsulfonylamino)butanedioic acid |
|---|---|
| PubChem CID | 141017674 |
| Molecular Formula | C16H13NO7S |
| Molecular Weight | 363.35 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | (2S)-2-(dibenzofuran-2-ylsulfonylamino)butanedioic acid |
| SMILES | O=C(O)C[C@H](NS(=O)(=O)c1ccc2oc3ccccc3c2c1)C(=O)O |
| InChI | InChI=1S/C16H13NO7S/c18-15(19)8-12(16(20)21)17-25(22,23)9-5-6-14-11(7-9)10-3-1-2-4-13(10)24-14/h1-7,12,17H,8H2,(H,18,19)(H,20,21)/t12-/m0/s1 |
| InChIKey | KLJMAQDORBAMIU-LBPRGKRZSA-N |
| XLogP | 1.79 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.35 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |