C13H15NO6S — CID 112733090
(2S)-2-(2,3-dihydro-1H-inden-5-ylsulfonylamino)butanedioic acid (PubChem CID 112733090) has the molecular formula C13H15NO6S and a molecular weight of 313.33 g/mol. Its IUPAC name is (2S)-2-(2,3-dihydro-1H-inden-5-ylsulfonylamino)butanedioic acid.
| Compound Name | (2S)-2-(2,3-dihydro-1H-inden-5-ylsulfonylamino)butanedioic acid |
|---|---|
| PubChem CID | 112733090 |
| Molecular Formula | C13H15NO6S |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | (2S)-2-(2,3-dihydro-1H-inden-5-ylsulfonylamino)butanedioic acid |
| SMILES | O=C(O)C[C@H](NS(=O)(=O)c1ccc2c(c1)CCC2)C(=O)O |
| InChI | InChI=1S/C13H15NO6S/c15-12(16)7-11(13(17)18)14-21(19,20)10-5-4-8-2-1-3-9(8)6-10/h4-6,11,14H,1-3,7H2,(H,15,16)(H,17,18)/t11-/m0/s1 |
| InChIKey | SXILSINZWXTQCS-NSHDSACASA-N |
| XLogP | 0.38 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |