C14H15NO5 — CID 112732992
(2S)-2-(2,3-dihydro-1H-indene-5-carbonylamino)butanedioic acid (PubChem CID 112732992) has the molecular formula C14H15NO5 and a molecular weight of 277.28 g/mol. Its IUPAC name is (2S)-2-(2,3-dihydro-1H-indene-5-carbonylamino)butanedioic acid.
| Compound Name | (2S)-2-(2,3-dihydro-1H-indene-5-carbonylamino)butanedioic acid |
|---|---|
| PubChem CID | 112732992 |
| Molecular Formula | C14H15NO5 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | (2S)-2-(2,3-dihydro-1H-indene-5-carbonylamino)butanedioic acid |
| SMILES | O=C(O)C[C@H](NC(=O)c1ccc2c(c1)CCC2)C(=O)O |
| InChI | InChI=1S/C14H15NO5/c16-12(17)7-11(14(19)20)15-13(18)10-5-4-8-2-1-3-9(8)6-10/h4-6,11H,1-3,7H2,(H,15,18)(H,16,17)(H,19,20)/t11-/m0/s1 |
| InChIKey | XWTWIHTZECVUHI-NSHDSACASA-N |
| XLogP | 0.83 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |