C13H15NO3 — CID 82348857
3-amino-4-(2,3-dihydro-1H-inden-5-yl)-4-oxobutanoic acid (PubChem CID 82348857) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is 3-amino-4-(2,3-dihydro-1H-inden-5-yl)-4-oxobutanoic acid.
| Compound Name | 3-amino-4-(2,3-dihydro-1H-inden-5-yl)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 82348857 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 3-amino-4-(2,3-dihydro-1H-inden-5-yl)-4-oxobutanoic acid |
| SMILES | NC(CC(=O)O)C(=O)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C13H15NO3/c14-11(7-12(15)16)13(17)10-5-4-8-2-1-3-9(8)6-10/h4-6,11H,1-3,7,14H2,(H,15,16) |
| InChIKey | UYGJHVXTBVRPRB-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |