3-amino-4-(2,3-dihydro-1H-inden-5-yl)-4-oxobutanoic acid

C13H15NO3 — CID 82348857

IUPAC3-amino-4-(2,3-dihydro-1H-inden-5-yl)-4-oxobutanoic acid
SMILESNC(CC(=O)O)C(=O)c1ccc2c(c1)CCC2
InChIInChI=1S/C13H15NO3/c14-11(7-12(15)16)13(17)10-5-4-8-2-1-3-9(8)6-10/h4-6,11H,1-3,7,14H2,(H,15,16)
InChIKeyUYGJHVXTBVRPRB-UHFFFAOYSA-N
MW233.27 g/mol
LogP1.16
Rot. Bonds4

About 3-amino-4-(2,3-dihydro-1H-inden-5-yl)-4-oxobutanoic acid

3-amino-4-(2,3-dihydro-1H-inden-5-yl)-4-oxobutanoic acid (PubChem CID 82348857) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is 3-amino-4-(2,3-dihydro-1H-inden-5-yl)-4-oxobutanoic acid.

Molecular Properties

Compound Name3-amino-4-(2,3-dihydro-1H-inden-5-yl)-4-oxobutanoic acid
PubChem CID82348857
Molecular FormulaC13H15NO3
Molecular Weight233.27 g/mol
Exact Mass233.11
IUPAC Name3-amino-4-(2,3-dihydro-1H-inden-5-yl)-4-oxobutanoic acid
SMILESNC(CC(=O)O)C(=O)c1ccc2c(c1)CCC2
InChIInChI=1S/C13H15NO3/c14-11(7-12(15)16)13(17)10-5-4-8-2-1-3-9(8)6-10/h4-6,11H,1-3,7,14H2,(H,15,16)
InChIKeyUYGJHVXTBVRPRB-UHFFFAOYSA-N
XLogP1.16
TPSA80.39 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500233.27
LogP ≤ 51.16
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 3-amino-4-(2,3-dihydro-1H-inden-5-yl)-4-oxobutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-amino-4-(2,3-dihydro-1H-inden-5-yl)-4-oxobutanoic acid?
The IUPAC name of 3-amino-4-(2,3-dihydro-1H-inden-5-yl)-4-oxobutanoic acid (CID 82348857) is 3-amino-4-(2,3-dihydro-1H-inden-5-yl)-4-oxobutanoic acid.
What is the SMILES notation for 3-amino-4-(2,3-dihydro-1H-inden-5-yl)-4-oxobutanoic acid?
The canonical SMILES for 3-amino-4-(2,3-dihydro-1H-inden-5-yl)-4-oxobutanoic acid is NC(CC(=O)O)C(=O)c1ccc2c(c1)CCC2.
What is the InChIKey of 3-amino-4-(2,3-dihydro-1H-inden-5-yl)-4-oxobutanoic acid?
The InChIKey is UYGJHVXTBVRPRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO3/c14-11(7-12(15)16)13(17)10-5-4-8-2-1-3-9(8)6-10/h4-6,11H,1-3,7,14H2,(H,15,16).
What are the key properties of 3-amino-4-(2,3-dihydro-1H-inden-5-yl)-4-oxobutanoic acid?
3-amino-4-(2,3-dihydro-1H-inden-5-yl)-4-oxobutanoic acid has a molecular weight of 233.27 g/mol, XLogP of 1.16, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4-(2,3-dihydro-1H-inden-5-yl)-4-oxobutanoic acid is sourced from PubChem (CID 82348857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).