C13H13NO7 — CID 78910227
2-(2,3-dihydro-1,4-benzodioxine-6-carbonylamino)butanedioic acid (PubChem CID 78910227) has the molecular formula C13H13NO7 and a molecular weight of 295.25 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzodioxine-6-carbonylamino)butanedioic acid.
| Compound Name | 2-(2,3-dihydro-1,4-benzodioxine-6-carbonylamino)butanedioic acid |
|---|---|
| PubChem CID | 78910227 |
| Molecular Formula | C13H13NO7 |
| Molecular Weight | 295.25 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzodioxine-6-carbonylamino)butanedioic acid |
| SMILES | O=C(O)CC(NC(=O)c1ccc2c(c1)OCCO2)C(=O)O |
| InChI | InChI=1S/C13H13NO7/c15-11(16)6-8(13(18)19)14-12(17)7-1-2-9-10(5-7)21-4-3-20-9/h1-2,5,8H,3-4,6H2,(H,14,17)(H,15,16)(H,18,19) |
| InChIKey | AGIVYKYQQFLPFI-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.25 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |