C30H34N2O16 — CID 10580401
(2R)-2-[[25-[[(1S)-1,2-dicarboxyethyl]carbamoyl]-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaene-11-carbonyl]amino]butanedioic acid (PubChem CID 10580401) has the molecular formula C30H34N2O16 and a molecular weight of 678.60 g/mol. Its IUPAC name is (2R)-2-[[25-[[(1S)-1,2-dicarboxyethyl]carbamoyl]-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaene-11-carbonyl]amino]butanedioic acid.
| Compound Name | (2R)-2-[[25-[[(1S)-1,2-dicarboxyethyl]carbamoyl]-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaene-11-carbonyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 10580401 |
| Molecular Formula | C30H34N2O16 |
| Molecular Weight | 678.60 g/mol |
| Exact Mass | 678.19 |
| IUPAC Name | (2R)-2-[[25-[[(1S)-1,2-dicarboxyethyl]carbamoyl]-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaene-11-carbonyl]amino]butanedioic acid |
| SMILES | O=C(O)C[C@H](NC(=O)c1ccc2c(c1)OCCOCCOc1cc(C(=O)N[C@H](CC(=O)O)C(=O)O)ccc1OCCOCCO2)C(=O)O |
| InChI | InChI=1S/C30H34N2O16/c33-25(34)15-19(29(39)40)31-27(37)17-1-3-21-23(13-17)47-11-7-44-8-12-48-24-14-18(28(38)32-20(30(41)42)16-26(35)36)2-4-22(24)46-10-6-43-5-9-45-21/h1-4,13-14,19-20H,5-12,15-16H2,(H,31,37)(H,32,38)(H,33,34)(H,35,36)(H,39,40)(H,41,42)/t19-,20+ |
| InChIKey | KXSYQUXLUCDXGH-BGYRXZFFSA-N |
| XLogP | 0.26 |
| TPSA | 262.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.60 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |