C13H14N2O6 — CID 43175930
5-amino-2-(1,3-benzodioxole-5-carbonylamino)-5-oxopentanoic acid (PubChem CID 43175930) has the molecular formula C13H14N2O6 and a molecular weight of 294.26 g/mol. Its IUPAC name is 5-amino-2-(1,3-benzodioxole-5-carbonylamino)-5-oxopentanoic acid.
| Compound Name | 5-amino-2-(1,3-benzodioxole-5-carbonylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 43175930 |
| Molecular Formula | C13H14N2O6 |
| Molecular Weight | 294.26 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 5-amino-2-(1,3-benzodioxole-5-carbonylamino)-5-oxopentanoic acid |
| SMILES | NC(=O)CCC(NC(=O)c1ccc2c(c1)OCO2)C(=O)O |
| InChI | InChI=1S/C13H14N2O6/c14-11(16)4-2-8(13(18)19)15-12(17)7-1-3-9-10(5-7)21-6-20-9/h1,3,5,8H,2,4,6H2,(H2,14,16)(H,15,17)(H,18,19) |
| InChIKey | VDQVXJMRHPLLPI-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 127.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.26 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |