C12H12N2O6 — CID 30050555
(2S)-4-amino-2-(1,3-benzodioxole-5-carbonylamino)-4-oxobutanoic acid (PubChem CID 30050555) has the molecular formula C12H12N2O6 and a molecular weight of 280.24 g/mol. Its IUPAC name is (2S)-4-amino-2-(1,3-benzodioxole-5-carbonylamino)-4-oxobutanoic acid.
| Compound Name | (2S)-4-amino-2-(1,3-benzodioxole-5-carbonylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 30050555 |
| Molecular Formula | C12H12N2O6 |
| Molecular Weight | 280.24 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | (2S)-4-amino-2-(1,3-benzodioxole-5-carbonylamino)-4-oxobutanoic acid |
| SMILES | NC(=O)C[C@H](NC(=O)c1ccc2c(c1)OCO2)C(=O)O |
| InChI | InChI=1S/C12H12N2O6/c13-10(15)4-7(12(17)18)14-11(16)6-1-2-8-9(3-6)20-5-19-8/h1-3,7H,4-5H2,(H2,13,15)(H,14,16)(H,17,18)/t7-/m0/s1 |
| InChIKey | MAPURZLAJHYGFD-ZETCQYMHSA-N |
| XLogP | -0.53 |
| TPSA | 127.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.24 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |