C11H11IN2O4 — CID 43084996
4-amino-2-[(4-iodobenzoyl)amino]-4-oxobutanoic acid (PubChem CID 43084996) has the molecular formula C11H11IN2O4 and a molecular weight of 362.12 g/mol. Its IUPAC name is 4-amino-2-[(4-iodobenzoyl)amino]-4-oxobutanoic acid.
| Compound Name | 4-amino-2-[(4-iodobenzoyl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 43084996 |
| Molecular Formula | C11H11IN2O4 |
| Molecular Weight | 362.12 g/mol |
| Exact Mass | 361.98 |
| IUPAC Name | 4-amino-2-[(4-iodobenzoyl)amino]-4-oxobutanoic acid |
| SMILES | NC(=O)CC(NC(=O)c1ccc(I)cc1)C(=O)O |
| InChI | InChI=1S/C11H11IN2O4/c12-7-3-1-6(2-4-7)10(16)14-8(11(17)18)5-9(13)15/h1-4,8H,5H2,(H2,13,15)(H,14,16)(H,17,18) |
| InChIKey | JTTFJZNDUZJDEO-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.12 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|